C10H13F3N2O — CID 118357663
1-ethyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-5-ol (PubChem CID 118357663) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 1-ethyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-5-ol.
| Compound Name | 1-ethyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-5-ol |
|---|---|
| PubChem CID | 118357663 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-ethyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-5-ol |
| SMILES | CCn1nc(C(F)(F)F)c2c1CCC(O)C2 |
| InChI | InChI=1S/C10H13F3N2O/c1-2-15-8-4-3-6(16)5-7(8)9(14-15)10(11,12)13/h6,16H,2-5H2,1H3 |
| InChIKey | IFNMGWGMIDTIKQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |