About 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one
3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 118357689) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one.
Molecular Properties
| Compound Name | 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one |
| PubChem CID | 118357689 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | CCc1c[nH]c2ccc(=O)[nH]c12 |
| InChI | InChI=1S/C9H10N2O/c1-2-6-5-10-7-3-4-8(12)11-9(6)7/h3-5,10H,2H2,1H3,(H,11,12) |
| InChIKey | FMJBWQWAUNSOCJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one?
The IUPAC name of 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one (CID 118357689) is 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one.
What is the SMILES notation for 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one?
The canonical SMILES for 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one is CCc1c[nH]c2ccc(=O)[nH]c12.
What is the InChIKey of 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one?
The InChIKey is FMJBWQWAUNSOCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-2-6-5-10-7-3-4-8(12)11-9(6)7/h3-5,10H,2H2,1H3,(H,11,12).
What are the key properties of 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one?
3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one has a molecular weight of 162.19 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,4-dihydropyrrolo[3,2-b]pyridin-5-one is sourced from PubChem (CID 118357689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).