C7H7F5N2 — CID 118357698
4-(difluoromethyl)-1-ethyl-3-(trifluoromethyl)pyrazole (PubChem CID 118357698) has the molecular formula C7H7F5N2 and a molecular weight of 214.14 g/mol. Its IUPAC name is 4-(difluoromethyl)-1-ethyl-3-(trifluoromethyl)pyrazole.
| Compound Name | 4-(difluoromethyl)-1-ethyl-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 118357698 |
| Molecular Formula | C7H7F5N2 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 4-(difluoromethyl)-1-ethyl-3-(trifluoromethyl)pyrazole |
| SMILES | CCn1cc(C(F)F)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H7F5N2/c1-2-14-3-4(6(8)9)5(13-14)7(10,11)12/h3,6H,2H2,1H3 |
| InChIKey | DAJUHTJUFYPAJY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |