C10H14F2N2O — CID 118357791
3-(difluoromethyl)-1-ethyl-4,5,6,7-tetrahydroindazol-7-ol (PubChem CID 118357791) has the molecular formula C10H14F2N2O and a molecular weight of 216.23 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-ethyl-4,5,6,7-tetrahydroindazol-7-ol.
| Compound Name | 3-(difluoromethyl)-1-ethyl-4,5,6,7-tetrahydroindazol-7-ol |
|---|---|
| PubChem CID | 118357791 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 3-(difluoromethyl)-1-ethyl-4,5,6,7-tetrahydroindazol-7-ol |
| SMILES | CCn1nc(C(F)F)c2c1C(O)CCC2 |
| InChI | InChI=1S/C10H14F2N2O/c1-2-14-9-6(4-3-5-7(9)15)8(13-14)10(11)12/h7,10,15H,2-5H2,1H3 |
| InChIKey | LHXJAIFBLXYZBO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |