C25H27F3N4O3 — CID 118357918
(3R)-N-[(1S,4E,6E)-1-[3-[(1E,3Z)-3-carbamoyl-4-fluorohexa-1,3,5-trienyl]-2-pyridinyl]-5,7-difluoro-3-methylidenehepta-4,6-dienyl]morpholine-3-carboxamide (PubChem CID 118357918) has the molecular formula C25H27F3N4O3 and a molecular weight of 488.51 g/mol. Its IUPAC name is (3R)-N-[(1S,4E,6E)-1-[3-[(1E,3Z)-3-carbamoyl-4-fluorohexa-1,3,5-trienyl]-2-pyridinyl]-5,7-difluoro-3-methylidenehepta-4,6-dienyl]morpholine-3-carboxamide.
| Compound Name | (3R)-N-[(1S,4E,6E)-1-[3-[(1E,3Z)-3-carbamoyl-4-fluorohexa-1,3,5-trienyl]-2-pyridinyl]-5,7-difluoro-3-methylidenehepta-4,6-dienyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 118357918 |
| Molecular Formula | C25H27F3N4O3 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | (3R)-N-[(1S,4E,6E)-1-[3-[(1E,3Z)-3-carbamoyl-4-fluorohexa-1,3,5-trienyl]-2-pyridinyl]-5,7-difluoro-3-methylidenehepta-4,6-dienyl]morpholine-3-carboxamide |
| SMILES | C=C/C(F)=C(\C=C\c1cccnc1[C@H](CC(=C)/C=C(F)\C=C\F)NC(=O)[C@H]1COCCN1)C(N)=O |
| InChI | InChI=1S/C25H27F3N4O3/c1-3-20(28)19(24(29)33)7-6-17-5-4-10-31-23(17)21(14-16(2)13-18(27)8-9-26)32-25(34)22-15-35-12-11-30-22/h3-10,13,21-22,30H,1-2,11-12,14-15H2,(H2,29,33)(H,32,34)/b7-6+,9-8+,18-13+,20-19-/t21-,22+/m0/s1 |
| InChIKey | RABWQYGVMFNWJL-XUKFQNEJSA-N |
| XLogP | 3.42 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|