About (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate
(1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate (PubChem CID 118358107) has the molecular formula C19H19N5O4
and a molecular weight of 381.39 g/mol. Its IUPAC name is (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate |
| PubChem CID | 118358107 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate |
| SMILES | CC(C)(CN=[N+]=[N-])OC(=O)c1ccn(CCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C19H19N5O4/c1-19(2,12-21-22-20)28-18(27)13-7-8-23(11-13)9-10-24-16(25)14-5-3-4-6-15(14)17(24)26/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | LVACALGTQMYIKB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 117.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate?
The IUPAC name of (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate (CID 118358107) is (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate.
What is the SMILES notation for (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate?
The canonical SMILES for (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate is CC(C)(CN=[N+]=[N-])OC(=O)c1ccn(CCN2C(=O)c3ccccc3C2=O)c1.
What is the InChIKey of (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate?
The InChIKey is LVACALGTQMYIKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O4/c1-19(2,12-21-22-20)28-18(27)13-7-8-23(11-13)9-10-24-16(25)14-5-3-4-6-15(14)17(24)26/h3-8,11H,9-10,12H2,1-2H3.
What are the key properties of (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate?
(1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate has a molecular weight of 381.39 g/mol, XLogP of 3.03, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-azido-2-methylpropan-2-yl) 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrole-3-carboxylate is sourced from PubChem (CID 118358107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).