About 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine
1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine (PubChem CID 118358336) has the molecular formula C4H11N5
and a molecular weight of 129.17 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine |
| PubChem CID | 118358336 |
| Molecular Formula | C4H11N5 |
| Molecular Weight | 129.17 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine |
| SMILES | CNC(C)C1=NNNN1 |
| InChI | InChI=1S/C4H11N5/c1-3(5-2)4-6-8-9-7-4/h3,5,8-9H,1-2H3,(H,6,7) |
| InChIKey | PNQWMDWESQJPSP-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.17 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine?
The IUPAC name of 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine (CID 118358336) is 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine.
What is the SMILES notation for 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine?
The canonical SMILES for 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine is CNC(C)C1=NNNN1.
What is the InChIKey of 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine?
The InChIKey is PNQWMDWESQJPSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N5/c1-3(5-2)4-6-8-9-7-4/h3,5,8-9H,1-2H3,(H,6,7).
What are the key properties of 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine?
1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine has a molecular weight of 129.17 g/mol, XLogP of -1.48, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1H-tetrazol-5-yl)-N-methylethanamine is sourced from PubChem (CID 118358336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).