About (E)-3,11-dimethyltetradec-2-en-1-imine
(E)-3,11-dimethyltetradec-2-en-1-imine (PubChem CID 118358413) has the molecular formula C16H31N
and a molecular weight of 237.43 g/mol. Its IUPAC name is (E)-3,11-dimethyltetradec-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-3,11-dimethyltetradec-2-en-1-imine |
| PubChem CID | 118358413 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (E)-3,11-dimethyltetradec-2-en-1-imine |
| SMILES | [H]/N=C/C=C(\C)CCCCCCCC(C)CCC |
| InChI | InChI=1S/C16H31N/c1-4-10-15(2)11-8-6-5-7-9-12-16(3)13-14-17/h13-15,17H,4-12H2,1-3H3/b16-13+,17-14+ |
| InChIKey | DDNMIPYAIUHDDO-DISAMGIASA-N |
| XLogP | 5.75 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,11-dimethyltetradec-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,11-dimethyltetradec-2-en-1-imine?
The IUPAC name of (E)-3,11-dimethyltetradec-2-en-1-imine (CID 118358413) is (E)-3,11-dimethyltetradec-2-en-1-imine.
What is the SMILES notation for (E)-3,11-dimethyltetradec-2-en-1-imine?
The canonical SMILES for (E)-3,11-dimethyltetradec-2-en-1-imine is [H]/N=C/C=C(\C)CCCCCCCC(C)CCC.
What is the InChIKey of (E)-3,11-dimethyltetradec-2-en-1-imine?
The InChIKey is DDNMIPYAIUHDDO-DISAMGIASA-N. The full InChI is InChI=1S/C16H31N/c1-4-10-15(2)11-8-6-5-7-9-12-16(3)13-14-17/h13-15,17H,4-12H2,1-3H3/b16-13+,17-14+.
What are the key properties of (E)-3,11-dimethyltetradec-2-en-1-imine?
(E)-3,11-dimethyltetradec-2-en-1-imine has a molecular weight of 237.43 g/mol, XLogP of 5.75, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,11-dimethyltetradec-2-en-1-imine is sourced from PubChem (CID 118358413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).