About 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid
5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid (PubChem CID 118358494) has the molecular formula C24H19F2N3O2
and a molecular weight of 419.43 g/mol. Its IUPAC name is 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid |
| PubChem CID | 118358494 |
| Molecular Formula | C24H19F2N3O2 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C2CC2)cnc1Nc1ccc2c(ccn2Cc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C24H19F2N3O2/c25-18-4-3-16(21(26)11-18)13-29-8-7-15-9-19(5-6-22(15)29)28-23-20(24(30)31)10-17(12-27-23)14-1-2-14/h3-12,14H,1-2,13H2,(H,27,28)(H,30,31) |
| InChIKey | JSGMVYGPWXNRHC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid?
The IUPAC name of 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid (CID 118358494) is 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid.
What is the SMILES notation for 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid?
The canonical SMILES for 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid is O=C(O)c1cc(C2CC2)cnc1Nc1ccc2c(ccn2Cc2ccc(F)cc2F)c1.
What is the InChIKey of 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid?
The InChIKey is JSGMVYGPWXNRHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F2N3O2/c25-18-4-3-16(21(26)11-18)13-29-8-7-15-9-19(5-6-22(15)29)28-23-20(24(30)31)10-17(12-27-23)14-1-2-14/h3-12,14H,1-2,13H2,(H,27,28)(H,30,31).
What are the key properties of 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid?
5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid has a molecular weight of 419.43 g/mol, XLogP of 5.68, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-2-[[1-[(2,4-difluorophenyl)methyl]indol-5-yl]amino]pyridine-3-carboxylic acid is sourced from PubChem (CID 118358494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).