C11H12O9S3 — CID 118358557
(1S)-8-methyl-1,8a-dihydronaphthalene-1,3,5-trisulfonic acid (PubChem CID 118358557) has the molecular formula C11H12O9S3 and a molecular weight of 384.41 g/mol. Its IUPAC name is (1S)-8-methyl-1,8a-dihydronaphthalene-1,3,5-trisulfonic acid.
| Compound Name | (1S)-8-methyl-1,8a-dihydronaphthalene-1,3,5-trisulfonic acid |
|---|---|
| PubChem CID | 118358557 |
| Molecular Formula | C11H12O9S3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | (1S)-8-methyl-1,8a-dihydronaphthalene-1,3,5-trisulfonic acid |
| SMILES | CC1=CC=C(S(=O)(=O)O)C2=CC(S(=O)(=O)O)=C[C@@H](S(=O)(=O)O)C12 |
| InChI | InChI=1S/C11H12O9S3/c1-6-2-3-9(22(15,16)17)8-4-7(21(12,13)14)5-10(11(6)8)23(18,19)20/h2-5,10-11H,1H3,(H,12,13,14)(H,15,16,17)(H,18,19,20)/t10-,11?/m1/s1 |
| InChIKey | GAWKBSRJXYJZPS-NFJWQWPMSA-N |
| XLogP | 0.30 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|