C14H20F2O6S — CID 118358659
(3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-methoxysulfonylacetate (PubChem CID 118358659) has the molecular formula C14H20F2O6S and a molecular weight of 354.37 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-methoxysulfonylacetate.
| Compound Name | (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-methoxysulfonylacetate |
|---|---|
| PubChem CID | 118358659 |
| Molecular Formula | C14H20F2O6S |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-methoxysulfonylacetate |
| SMILES | COS(=O)(=O)C(F)(F)C(=O)OCC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C14H20F2O6S/c1-21-23(19,20)14(15,16)11(17)22-8-12-3-9-2-10(4-12)6-13(18,5-9)7-12/h9-10,18H,2-8H2,1H3 |
| InChIKey | PVWRNHJURHQKGB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|