About 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran
5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran (PubChem CID 118358989) has the molecular formula C18H21F3O
and a molecular weight of 310.36 g/mol. Its IUPAC name is 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran |
| PubChem CID | 118358989 |
| Molecular Formula | C18H21F3O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1CCC(/C(F)=C(\F)c2ccc(F)cc2)=CO1 |
| InChI | InChI=1S/C18H21F3O/c1-2-3-4-5-16-11-8-14(12-22-16)18(21)17(20)13-6-9-15(19)10-7-13/h6-7,9-10,12,16H,2-5,8,11H2,1H3/b18-17+ |
| InChIKey | AWBMVHDKJWFNIG-ISLYRVAYSA-N |
| XLogP | 6.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran?
The IUPAC name of 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran (CID 118358989) is 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran?
The canonical SMILES for 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran is CCCCCC1CCC(/C(F)=C(\F)c2ccc(F)cc2)=CO1.
What is the InChIKey of 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran?
The InChIKey is AWBMVHDKJWFNIG-ISLYRVAYSA-N. The full InChI is InChI=1S/C18H21F3O/c1-2-3-4-5-16-11-8-14(12-22-16)18(21)17(20)13-6-9-15(19)10-7-13/h6-7,9-10,12,16H,2-5,8,11H2,1H3/b18-17+.
What are the key properties of 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran?
5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran has a molecular weight of 310.36 g/mol, XLogP of 6.08, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-1,2-difluoro-2-(4-fluorophenyl)ethenyl]-2-pentyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 118358989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).