C14H20N6 — CID 118360199
N,N,N',N'-tetramethyl-N"-pyridin-3-yl-N"-pyrimidin-5-ylmethanetriamine (PubChem CID 118360199) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is N,N,N',N'-tetramethyl-N"-pyridin-3-yl-N"-pyrimidin-5-ylmethanetriamine.
| Compound Name | N,N,N',N'-tetramethyl-N"-pyridin-3-yl-N"-pyrimidin-5-ylmethanetriamine |
|---|---|
| PubChem CID | 118360199 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N,N,N',N'-tetramethyl-N"-pyridin-3-yl-N"-pyrimidin-5-ylmethanetriamine |
| SMILES | CN(C)C(N(C)C)N(c1cccnc1)c1cncnc1 |
| InChI | InChI=1S/C14H20N6/c1-18(2)14(19(3)4)20(12-6-5-7-15-8-12)13-9-16-11-17-10-13/h5-11,14H,1-4H3 |
| InChIKey | LBANYIGHHCDSDL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|