C59H54N2 — CID 118360263
4-N,17-N-bis(4-tert-butylphenyl)-20,20-dimethyl-4-N,17-N-diphenylhexacyclo[11.11.1.02,11.05,10.014,19.021,25]pentacosa-1,3,5,7,9,11,13(25),14(19),15,17,21,23-dodecaene-4,17-diamine (PubChem CID 118360263) has the molecular formula C59H54N2 and a molecular weight of 791.10 g/mol. Its IUPAC name is 4-N,17-N-bis(4-tert-butylphenyl)-20,20-dimethyl-4-N,17-N-diphenylhexacyclo[11.11.1.02,11.05,10.014,19.021,25]pentacosa-1,3,5,7,9,11,13(25),14(19),15,17,21,23-dodecaene-4,17-diamine.
| Compound Name | 4-N,17-N-bis(4-tert-butylphenyl)-20,20-dimethyl-4-N,17-N-diphenylhexacyclo[11.11.1.02,11.05,10.014,19.021,25]pentacosa-1,3,5,7,9,11,13(25),14(19),15,17,21,23-dodecaene-4,17-diamine |
|---|---|
| PubChem CID | 118360263 |
| Molecular Formula | C59H54N2 |
| Molecular Weight | 791.10 g/mol |
| Exact Mass | 790.43 |
| IUPAC Name | 4-N,17-N-bis(4-tert-butylphenyl)-20,20-dimethyl-4-N,17-N-diphenylhexacyclo[11.11.1.02,11.05,10.014,19.021,25]pentacosa-1,3,5,7,9,11,13(25),14(19),15,17,21,23-dodecaene-4,17-diamine |
| SMILES | CC(C)(C)c1ccc(N(c2ccccc2)c2ccc3c(c2)C(C)(C)c2cccc4c2c-3cc2c3ccccc3c(N(c3ccccc3)c3ccc(C(C)(C)C)cc3)cc42)cc1 |
| InChI | InChI=1S/C59H54N2/c1-57(2,3)39-26-30-43(31-27-39)60(41-18-11-9-12-19-41)45-34-35-47-52-37-50-46-22-15-16-23-48(46)55(38-51(50)49-24-17-25-53(56(49)52)59(7,8)54(47)36-45)61(42-20-13-10-14-21-42)44-32-28-40(29-33-44)58(4,5)6/h9-38H,1-8H3 |
| InChIKey | QXYFRIVPOFPHCJ-UHFFFAOYSA-N |
| XLogP | 16.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.10 |
| LogP ≤ 5 | 16.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|