C33H32NO2P — CID 118360675
[(1R,10S,14S)-12,20-dimethyl-2,22-dioxa-12-azapentacyclo[12.8.0.01,10.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaen-4-yl]-diphenylphosphane (PubChem CID 118360675) has the molecular formula C33H32NO2P and a molecular weight of 505.60 g/mol. Its IUPAC name is [(1R,10S,14S)-12,20-dimethyl-2,22-dioxa-12-azapentacyclo[12.8.0.01,10.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaen-4-yl]-diphenylphosphane.
| Compound Name | [(1R,10S,14S)-12,20-dimethyl-2,22-dioxa-12-azapentacyclo[12.8.0.01,10.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaen-4-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 118360675 |
| Molecular Formula | C33H32NO2P |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | [(1R,10S,14S)-12,20-dimethyl-2,22-dioxa-12-azapentacyclo[12.8.0.01,10.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaen-4-yl]-diphenylphosphane |
| SMILES | Cc1cccc2c1O[C@]13Oc4c(cccc4P(c4ccccc4)c4ccccc4)C[C@H]1CN(C)C[C@@H]3C2 |
| InChI | InChI=1S/C33H32NO2P/c1-23-11-9-12-24-19-26-21-34(2)22-27-20-25-13-10-18-30(32(25)36-33(26,27)35-31(23)24)37(28-14-5-3-6-15-28)29-16-7-4-8-17-29/h3-18,26-27H,19-22H2,1-2H3/t26-,27-,33+/m0/s1 |
| InChIKey | NRWONLGZYOLUJM-ZTMGNVKNSA-N |
| XLogP | 5.20 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|