C25H25FN8O — CID 118361415
N-[3-fluoro-5-[6-[3-(4-methylpiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 118361415) has the molecular formula C25H25FN8O and a molecular weight of 472.53 g/mol. Its IUPAC name is N-[3-fluoro-5-[6-[3-(4-methylpiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-fluoro-5-[6-[3-(4-methylpiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118361415 |
| Molecular Formula | C25H25FN8O |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[3-fluoro-5-[6-[3-(4-methylpiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(F)cc(-c2nc(Nc3cccc(N4CCN(C)CC4)c3)nc3[nH]ncc23)c1 |
| InChI | InChI=1S/C25H25FN8O/c1-3-22(35)28-19-12-16(11-17(26)13-19)23-21-15-27-32-24(21)31-25(30-23)29-18-5-4-6-20(14-18)34-9-7-33(2)8-10-34/h3-6,11-15H,1,7-10H2,2H3,(H,28,35)(H2,27,29,30,31,32) |
| InChIKey | JCPOAFXXTDLQNO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|