C21H35NO9 — CID 118362431
[(3R)-2-[(1R,2S)-2-acetamido-1-cyclohexyloxypropoxy]-3,4-diacetyloxybutyl] acetate (PubChem CID 118362431) has the molecular formula C21H35NO9 and a molecular weight of 445.51 g/mol. Its IUPAC name is [(3R)-2-[(1R,2S)-2-acetamido-1-cyclohexyloxypropoxy]-3,4-diacetyloxybutyl] acetate.
| Compound Name | [(3R)-2-[(1R,2S)-2-acetamido-1-cyclohexyloxypropoxy]-3,4-diacetyloxybutyl] acetate |
|---|---|
| PubChem CID | 118362431 |
| Molecular Formula | C21H35NO9 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [(3R)-2-[(1R,2S)-2-acetamido-1-cyclohexyloxypropoxy]-3,4-diacetyloxybutyl] acetate |
| SMILES | CC(=O)N[C@@H](C)[C@H](OC1CCCCC1)OC(COC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C21H35NO9/c1-13(22-14(2)23)21(30-18-9-7-6-8-10-18)31-20(12-28-16(4)25)19(29-17(5)26)11-27-15(3)24/h13,18-21H,6-12H2,1-5H3,(H,22,23)/t13-,19+,20?,21+/m0/s1 |
| InChIKey | NFXCVORNQITGDZ-MKGAXTOOSA-N |
| XLogP | 1.63 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|