About [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine
[(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine (PubChem CID 118362887) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine.
Molecular Properties
| Compound Name | [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine |
| PubChem CID | 118362887 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine |
| SMILES | C=C(C)/C=C\C(=C/C)CCNN |
| InChI | InChI=1S/C10H18N2/c1-4-10(7-8-12-11)6-5-9(2)3/h4-6,12H,2,7-8,11H2,1,3H3/b6-5-,10-4+ |
| InChIKey | IGHIQRIUKWDXMY-QYONPMAVSA-N |
| XLogP | 1.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine?
The IUPAC name of [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine (CID 118362887) is [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine.
What is the SMILES notation for [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine?
The canonical SMILES for [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine is C=C(C)/C=C\C(=C/C)CCNN.
What is the InChIKey of [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine?
The InChIKey is IGHIQRIUKWDXMY-QYONPMAVSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-10(7-8-12-11)6-5-9(2)3/h4-6,12H,2,7-8,11H2,1,3H3/b6-5-,10-4+.
What are the key properties of [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine?
[(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine has a molecular weight of 166.27 g/mol, XLogP of 1.92, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z,4Z)-3-ethylidene-6-methylhepta-4,6-dienyl]hydrazine is sourced from PubChem (CID 118362887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).