C14H22O2 — CID 118362943
ethyl 2,4,5,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene-3-carboxylate (PubChem CID 118362943) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is ethyl 2,4,5,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene-3-carboxylate.
| Compound Name | ethyl 2,4,5,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene-3-carboxylate |
|---|---|
| PubChem CID | 118362943 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | ethyl 2,4,5,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene-3-carboxylate |
| SMILES | CCOC(=O)C1=C2CCCCCCC2CC1 |
| InChI | InChI=1S/C14H22O2/c1-2-16-14(15)13-10-9-11-7-5-3-4-6-8-12(11)13/h11H,2-10H2,1H3 |
| InChIKey | JIBIMQKNOIRAJR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |