C8H16O4 — CID 118362949
(4R)-2-(hydroxymethyl)-4,5-dimethyloxane-2,3-diol (PubChem CID 118362949) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (4R)-2-(hydroxymethyl)-4,5-dimethyloxane-2,3-diol.
| Compound Name | (4R)-2-(hydroxymethyl)-4,5-dimethyloxane-2,3-diol |
|---|---|
| PubChem CID | 118362949 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (4R)-2-(hydroxymethyl)-4,5-dimethyloxane-2,3-diol |
| SMILES | CC1COC(O)(CO)C(O)[C@@H]1C |
| InChI | InChI=1S/C8H16O4/c1-5-3-12-8(11,4-9)7(10)6(5)2/h5-7,9-11H,3-4H2,1-2H3/t5?,6-,7?,8?/m1/s1 |
| InChIKey | HZSVHSCISVFOIJ-QQJWGCFSSA-N |
| XLogP | -0.67 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |