C41H33N3 — CID 118363119
2-[3-anthracen-9-yl-5-(1,2-dihydropyridin-6-yl)phenyl]-6-cyclohexa-2,4-dien-1-yl-4-phenyl-1,2-dihydropyrimidine (PubChem CID 118363119) has the molecular formula C41H33N3 and a molecular weight of 567.74 g/mol. Its IUPAC name is 2-[3-anthracen-9-yl-5-(1,2-dihydropyridin-6-yl)phenyl]-6-cyclohexa-2,4-dien-1-yl-4-phenyl-1,2-dihydropyrimidine.
| Compound Name | 2-[3-anthracen-9-yl-5-(1,2-dihydropyridin-6-yl)phenyl]-6-cyclohexa-2,4-dien-1-yl-4-phenyl-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 118363119 |
| Molecular Formula | C41H33N3 |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 2-[3-anthracen-9-yl-5-(1,2-dihydropyridin-6-yl)phenyl]-6-cyclohexa-2,4-dien-1-yl-4-phenyl-1,2-dihydropyrimidine |
| SMILES | C1=CCNC(c2cc(-c3c4ccccc4cc4ccccc34)cc(C3N=C(c4ccccc4)C=C(C4C=CC=CC4)N3)c2)=C1 |
| InChI | InChI=1S/C41H33N3/c1-3-13-28(14-4-1)38-27-39(29-15-5-2-6-16-29)44-41(43-38)34-25-32(37-21-11-12-22-42-37)24-33(26-34)40-35-19-9-7-17-30(35)23-31-18-8-10-20-36(31)40/h1-15,17-21,23-27,29,41-42,44H,16,22H2 |
| InChIKey | NSGBBDWIZCTDTP-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|