About carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate
carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate (PubChem CID 11836528) has the molecular formula C11H10Cl3N3S
and a molecular weight of 322.65 g/mol. Its IUPAC name is carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate.
Molecular Properties
| Compound Name | carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate |
| PubChem CID | 11836528 |
| Molecular Formula | C11H10Cl3N3S |
| Molecular Weight | 322.65 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate |
| SMILES | [H]/N=C(\N)S/C(=N/C(Cl)=C(Cl)Cl)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H10Cl3N3S/c1-6-2-4-7(5-3-6)10(18-11(15)16)17-9(14)8(12)13/h2-5H,1H3,(H3,15,16)/b17-10+ |
| InChIKey | INDUVVDODFYOPI-LICLKQGHSA-N |
| XLogP | 4.21 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate?
The IUPAC name of carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate (CID 11836528) is carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate.
What is the SMILES notation for carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate?
The canonical SMILES for carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate is [H]/N=C(\N)S/C(=N/C(Cl)=C(Cl)Cl)c1ccc(C)cc1.
What is the InChIKey of carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate?
The InChIKey is INDUVVDODFYOPI-LICLKQGHSA-N. The full InChI is InChI=1S/C11H10Cl3N3S/c1-6-2-4-7(5-3-6)10(18-11(15)16)17-9(14)8(12)13/h2-5H,1H3,(H3,15,16)/b17-10+.
What are the key properties of carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate?
carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate has a molecular weight of 322.65 g/mol, XLogP of 4.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamimidoyl (1E)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate is sourced from PubChem (CID 11836528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).