C28H36N2O8 — CID 118365475
(2S,3S,4S,5R)-2-[9,10-bis(4-nitrophenyl)undec-10-en-2-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 118365475) has the molecular formula C28H36N2O8 and a molecular weight of 528.60 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-[9,10-bis(4-nitrophenyl)undec-10-en-2-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-[9,10-bis(4-nitrophenyl)undec-10-en-2-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 118365475 |
| Molecular Formula | C28H36N2O8 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | (2S,3S,4S,5R)-2-[9,10-bis(4-nitrophenyl)undec-10-en-2-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C=C(c1ccc([N+](=O)[O-])cc1)C(CCCCCCC(C)[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H36N2O8/c1-18(28-27(33)26(32)25(17-31)38-28)7-5-3-4-6-8-24(21-11-15-23(16-12-21)30(36)37)19(2)20-9-13-22(14-10-20)29(34)35/h9-16,18,24-28,31-33H,2-8,17H2,1H3/t18?,24?,25-,26-,27+,28+/m1/s1 |
| InChIKey | SMODBRLIOJTRLY-UFSJCWOESA-N |
| XLogP | 4.76 |
| TPSA | 156.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|