C20H24BrNO — CID 11836641
(4Z,8E)-N-(3-bromophenyl)bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide (PubChem CID 11836641) has the molecular formula C20H24BrNO and a molecular weight of 374.32 g/mol. Its IUPAC name is (4Z,8E)-N-(3-bromophenyl)bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide.
| Compound Name | (4Z,8E)-N-(3-bromophenyl)bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide |
|---|---|
| PubChem CID | 11836641 |
| Molecular Formula | C20H24BrNO |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (4Z,8E)-N-(3-bromophenyl)bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)C1C2CC/C=C\CC/C=C/CCC21 |
| InChI | InChI=1S/C20H24BrNO/c21-15-10-9-11-16(14-15)22-20(23)19-17-12-7-5-3-1-2-4-6-8-13-18(17)19/h3-6,9-11,14,17-19H,1-2,7-8,12-13H2,(H,22,23)/b5-3-,6-4+ |
| InChIKey | KVFSWFSBUJJKAD-CIIODKQPSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|