C26H33N5O4 — CID 118366440
3-[2-[1-[6-(3-hydroxypiperidin-1-yl)-2-pyridinyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 118366440) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is 3-[2-[1-[6-(3-hydroxypiperidin-1-yl)-2-pyridinyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-[1-[6-(3-hydroxypiperidin-1-yl)-2-pyridinyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 118366440 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 3-[2-[1-[6-(3-hydroxypiperidin-1-yl)-2-pyridinyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)NC3(CCCCC3)C2=O)c(C)n1-c1cccc(N2CCCC(O)C2)n1 |
| InChI | InChI=1S/C26H33N5O4/c1-17-14-20(21(33)16-30-24(34)26(28-25(30)35)11-4-3-5-12-26)18(2)31(17)23-10-6-9-22(27-23)29-13-7-8-19(32)15-29/h6,9-10,14,19,32H,3-5,7-8,11-13,15-16H2,1-2H3,(H,28,35) |
| InChIKey | RPXAKZDOHFWKLD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|