C23H22F2N2O4 — CID 118366514
8,8-difluoro-3-[2-[4-[2-(hydroxymethyl)phenyl]phenyl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 118366514) has the molecular formula C23H22F2N2O4 and a molecular weight of 428.44 g/mol. Its IUPAC name is 8,8-difluoro-3-[2-[4-[2-(hydroxymethyl)phenyl]phenyl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8,8-difluoro-3-[2-[4-[2-(hydroxymethyl)phenyl]phenyl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 118366514 |
| Molecular Formula | C23H22F2N2O4 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 8,8-difluoro-3-[2-[4-[2-(hydroxymethyl)phenyl]phenyl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(CN1C(=O)NC2(CCC(F)(F)CC2)C1=O)c1ccc(-c2ccccc2CO)cc1 |
| InChI | InChI=1S/C23H22F2N2O4/c24-23(25)11-9-22(10-12-23)20(30)27(21(31)26-22)13-19(29)16-7-5-15(6-8-16)18-4-2-1-3-17(18)14-28/h1-8,28H,9-14H2,(H,26,31) |
| InChIKey | KHKWPZRMCRYPBK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|