About (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane
(4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane (PubChem CID 118366658) has the molecular formula C9H13F3O2
and a molecular weight of 210.19 g/mol. Its IUPAC name is (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane.
Molecular Properties
| Compound Name | (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane |
| PubChem CID | 118366658 |
| Molecular Formula | C9H13F3O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane |
| SMILES | CO/C=C1\CCOC(CC(F)(F)F)C1 |
| InChI | InChI=1S/C9H13F3O2/c1-13-6-7-2-3-14-8(4-7)5-9(10,11)12/h6,8H,2-5H2,1H3/b7-6+ |
| InChIKey | UMBXSOIAFHMUGV-VOTSOKGWSA-N |
| XLogP | 2.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane?
The IUPAC name of (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane (CID 118366658) is (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane.
What is the SMILES notation for (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane?
The canonical SMILES for (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane is CO/C=C1\CCOC(CC(F)(F)F)C1.
What is the InChIKey of (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane?
The InChIKey is UMBXSOIAFHMUGV-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H13F3O2/c1-13-6-7-2-3-14-8(4-7)5-9(10,11)12/h6,8H,2-5H2,1H3/b7-6+.
What are the key properties of (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane?
(4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane has a molecular weight of 210.19 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-(methoxymethylidene)-2-(2,2,2-trifluoroethyl)oxane is sourced from PubChem (CID 118366658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).