About 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde
2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde (PubChem CID 118366700) has the molecular formula C8H11F3O2
and a molecular weight of 196.17 g/mol. Its IUPAC name is 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde |
| PubChem CID | 118366700 |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde |
| SMILES | O=CC1CCOC(C(F)C(F)F)C1 |
| InChI | InChI=1S/C8H11F3O2/c9-7(8(10)11)6-3-5(4-12)1-2-13-6/h4-8H,1-3H2 |
| InChIKey | DFAQKIAPTBHUMU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde?
The IUPAC name of 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde (CID 118366700) is 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde.
What is the SMILES notation for 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde?
The canonical SMILES for 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde is O=CC1CCOC(C(F)C(F)F)C1.
What is the InChIKey of 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde?
The InChIKey is DFAQKIAPTBHUMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3O2/c9-7(8(10)11)6-3-5(4-12)1-2-13-6/h4-8H,1-3H2.
What are the key properties of 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde?
2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde has a molecular weight of 196.17 g/mol, XLogP of 1.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,2-trifluoroethyl)oxane-4-carbaldehyde is sourced from PubChem (CID 118366700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).