C19H13F4N5O3S — CID 118366771
5-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-2-(1-oxidopyridin-1-ium-3-yl)pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 118366771) has the molecular formula C19H13F4N5O3S and a molecular weight of 467.40 g/mol. Its IUPAC name is 5-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-2-(1-oxidopyridin-1-ium-3-yl)pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 5-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-2-(1-oxidopyridin-1-ium-3-yl)pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 118366771 |
| Molecular Formula | C19H13F4N5O3S |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 5-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-2-(1-oxidopyridin-1-ium-3-yl)pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | Cc1cc(F)c(-n2cnc3nn(-c4ccc[n+]([O-])c4)cc3c2=O)cc1S(=O)CC(F)(F)F |
| InChI | InChI=1S/C19H13F4N5O3S/c1-11-5-14(20)15(6-16(11)32(31)9-19(21,22)23)27-10-24-17-13(18(27)29)8-28(25-17)12-3-2-4-26(30)7-12/h2-8,10H,9H2,1H3 |
| InChIKey | PVVBZXXANBWLJW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|