C23H29N5O3 — CID 118366955
N-hydroxy-4-[3-(7-propan-2-yl-2-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-4-yl)phenoxy]butanamide (PubChem CID 118366955) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-hydroxy-4-[3-(7-propan-2-yl-2-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-4-yl)phenoxy]butanamide.
| Compound Name | N-hydroxy-4-[3-(7-propan-2-yl-2-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-4-yl)phenoxy]butanamide |
|---|---|
| PubChem CID | 118366955 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-hydroxy-4-[3-(7-propan-2-yl-2-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-4-yl)phenoxy]butanamide |
| SMILES | CC(C)n1ccc2c(-c3cccc(OCCCC(=O)NO)c3)nc(N3CCCC3)nc21 |
| InChI | InChI=1S/C23H29N5O3/c1-16(2)28-13-10-19-21(24-23(25-22(19)28)27-11-3-4-12-27)17-7-5-8-18(15-17)31-14-6-9-20(29)26-30/h5,7-8,10,13,15-16,30H,3-4,6,9,11-12,14H2,1-2H3,(H,26,29) |
| InChIKey | VZVYHTFJYZJTHA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|