C25H28N8O4 — CID 118366989
N-hydroxy-4-[[2-[2-(6-methoxy-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]ethylamino]methyl]benzamide (PubChem CID 118366989) has the molecular formula C25H28N8O4 and a molecular weight of 504.55 g/mol. Its IUPAC name is N-hydroxy-4-[[2-[2-(6-methoxy-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]ethylamino]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[2-[2-(6-methoxy-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]ethylamino]methyl]benzamide |
|---|---|
| PubChem CID | 118366989 |
| Molecular Formula | C25H28N8O4 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | N-hydroxy-4-[[2-[2-(6-methoxy-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]ethylamino]methyl]benzamide |
| SMILES | COc1ccc(-c2nc(N3CCOCC3)c3ncn(CCNCc4ccc(C(=O)NO)cc4)c3n2)cn1 |
| InChI | InChI=1S/C25H28N8O4/c1-36-20-7-6-19(15-27-20)22-29-23(32-10-12-37-13-11-32)21-24(30-22)33(16-28-21)9-8-26-14-17-2-4-18(5-3-17)25(34)31-35/h2-7,15-16,26,35H,8-14H2,1H3,(H,31,34) |
| InChIKey | TVMUCZDLQIKGHP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|