C23H27N3O3 — CID 118367413
2-[[(3R,5S)-4-benzyl-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxy-1-benzofuran-5-carboxamide (PubChem CID 118367413) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[[(3R,5S)-4-benzyl-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxy-1-benzofuran-5-carboxamide.
| Compound Name | 2-[[(3R,5S)-4-benzyl-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxy-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 118367413 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-[[(3R,5S)-4-benzyl-3,5-dimethylpiperazin-1-yl]methyl]-N-hydroxy-1-benzofuran-5-carboxamide |
| SMILES | C[C@@H]1CN(Cc2cc3cc(C(=O)NO)ccc3o2)C[C@H](C)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H27N3O3/c1-16-12-25(13-17(2)26(16)14-18-6-4-3-5-7-18)15-21-11-20-10-19(23(27)24-28)8-9-22(20)29-21/h3-11,16-17,28H,12-15H2,1-2H3,(H,24,27)/t16-,17+ |
| InChIKey | ZBIRXFHHWABRJS-CALCHBBNSA-N |
| XLogP | 3.65 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|