C22H26N4O7S2 — CID 118368760
(2R)-N-hydroxy-4-[6-[2-[4-(methanesulfonamidomethyl)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 118368760) has the molecular formula C22H26N4O7S2 and a molecular weight of 522.61 g/mol. Its IUPAC name is (2R)-N-hydroxy-4-[6-[2-[4-(methanesulfonamidomethyl)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-N-hydroxy-4-[6-[2-[4-(methanesulfonamidomethyl)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 118368760 |
| Molecular Formula | C22H26N4O7S2 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | (2R)-N-hydroxy-4-[6-[2-[4-(methanesulfonamidomethyl)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCN1Cc2cc(C#Cc3ccc(CNS(C)(=O)=O)cc3)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C22H26N4O7S2/c1-22(20(27)24-29,34(2,30)31)10-11-25-15-19-12-18(14-26(19)21(25)28)9-6-16-4-7-17(8-5-16)13-23-35(3,32)33/h4-5,7-8,12,14,23,29H,10-11,13,15H2,1-3H3,(H,24,27)/t22-/m1/s1 |
| InChIKey | QSPASSAXRORLKO-JOCHJYFZSA-N |
| XLogP | 0.42 |
| TPSA | 154.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|