C18H22N4O7S2 — CID 118368821
(2R)-N-hydroxy-4-[6-[5-(methanesulfonamido)penta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 118368821) has the molecular formula C18H22N4O7S2 and a molecular weight of 470.53 g/mol. Its IUPAC name is (2R)-N-hydroxy-4-[6-[5-(methanesulfonamido)penta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-N-hydroxy-4-[6-[5-(methanesulfonamido)penta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 118368821 |
| Molecular Formula | C18H22N4O7S2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | (2R)-N-hydroxy-4-[6-[5-(methanesulfonamido)penta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCN1Cc2cc(C#CC#CCNS(C)(=O)=O)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C18H22N4O7S2/c1-18(16(23)20-25,30(2,26)27)8-10-21-13-15-11-14(12-22(15)17(21)24)7-5-4-6-9-19-31(3,28)29/h11-12,19,25H,8-10,13H2,1-3H3,(H,20,23)/t18-/m1/s1 |
| InChIKey | ZMINVWIIEVWCDZ-GOSISDBHSA-N |
| XLogP | -1.13 |
| TPSA | 154.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|