C19H19ClF3N5O — CID 118368954
[3-[2-(5-chloro-3-methyl-2-pyridinyl)-6-fluoro-1,4-dihydroquinazolin-7-yl]-2,2-difluorobutyl] carbamimidate (PubChem CID 118368954) has the molecular formula C19H19ClF3N5O and a molecular weight of 425.84 g/mol. Its IUPAC name is [3-[2-(5-chloro-3-methyl-2-pyridinyl)-6-fluoro-1,4-dihydroquinazolin-7-yl]-2,2-difluorobutyl] carbamimidate.
| Compound Name | [3-[2-(5-chloro-3-methyl-2-pyridinyl)-6-fluoro-1,4-dihydroquinazolin-7-yl]-2,2-difluorobutyl] carbamimidate |
|---|---|
| PubChem CID | 118368954 |
| Molecular Formula | C19H19ClF3N5O |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [3-[2-(5-chloro-3-methyl-2-pyridinyl)-6-fluoro-1,4-dihydroquinazolin-7-yl]-2,2-difluorobutyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCC(F)(F)C(C)c1cc2c(cc1F)CN=C(c1ncc(Cl)cc1C)N2 |
| InChI | InChI=1S/C19H19ClF3N5O/c1-9-3-12(20)7-26-16(9)17-27-6-11-4-14(21)13(5-15(11)28-17)10(2)19(22,23)8-29-18(24)25/h3-5,7,10H,6,8H2,1-2H3,(H3,24,25)(H,27,28) |
| InChIKey | MRVIECYSOYBCJL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|