C6H7N3 — CID 118369191
5,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 118369191) has the molecular formula C6H7N3 and a molecular weight of 121.14 g/mol. Its IUPAC name is 5,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 5,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 118369191 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 5,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | C1=CCn2cnnc2C1 |
| InChI | InChI=1S/C6H7N3/c1-2-4-9-5-7-8-6(9)3-1/h1-2,5H,3-4H2 |
| InChIKey | IPOSBVGWCWJPNH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|