C12H17ClN2O4S — CID 118369212
[3-(2-chloroethyl)-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] methanesulfonate (PubChem CID 118369212) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is [3-(2-chloroethyl)-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] methanesulfonate.
| Compound Name | [3-(2-chloroethyl)-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] methanesulfonate |
|---|---|
| PubChem CID | 118369212 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | [3-(2-chloroethyl)-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] methanesulfonate |
| SMILES | Cc1nc2n(c(=O)c1CCCl)CCCC2OS(C)(=O)=O |
| InChI | InChI=1S/C12H17ClN2O4S/c1-8-9(5-6-13)12(16)15-7-3-4-10(11(15)14-8)19-20(2,17)18/h10H,3-7H2,1-2H3 |
| InChIKey | RRIDEUCMHOUPMQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|