About 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine
4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine (PubChem CID 118369215) has the molecular formula C7H8N2S
and a molecular weight of 152.22 g/mol. Its IUPAC name is 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine |
| PubChem CID | 118369215 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine |
| SMILES | C1=CNc2sccc2CN1 |
| InChI | InChI=1S/C7H8N2S/c1-4-10-7-6(1)5-8-2-3-9-7/h1-4,8-9H,5H2 |
| InChIKey | RYESSSXSBPIDTG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine?
The IUPAC name of 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine (CID 118369215) is 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine.
What is the SMILES notation for 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine?
The canonical SMILES for 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine is C1=CNc2sccc2CN1.
What is the InChIKey of 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine?
The InChIKey is RYESSSXSBPIDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2S/c1-4-10-7-6(1)5-8-2-3-9-7/h1-4,8-9H,5H2.
What are the key properties of 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine?
4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine has a molecular weight of 152.22 g/mol, XLogP of 1.73, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-thieno[2,3-e][1,4]diazepine is sourced from PubChem (CID 118369215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).