C21H23N5O — CID 118369299
3-[2-methyl-4-(1-methylpyrazol-4-yl)pyrimido[1,2-b]indazol-3-yl]hex-1-en-2-ol (PubChem CID 118369299) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 3-[2-methyl-4-(1-methylpyrazol-4-yl)pyrimido[1,2-b]indazol-3-yl]hex-1-en-2-ol.
| Compound Name | 3-[2-methyl-4-(1-methylpyrazol-4-yl)pyrimido[1,2-b]indazol-3-yl]hex-1-en-2-ol |
|---|---|
| PubChem CID | 118369299 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 3-[2-methyl-4-(1-methylpyrazol-4-yl)pyrimido[1,2-b]indazol-3-yl]hex-1-en-2-ol |
| SMILES | C=C(O)C(CCC)c1c(C)nc2c3ccccc3nn2c1-c1cnn(C)c1 |
| InChI | InChI=1S/C21H23N5O/c1-5-8-16(14(3)27)19-13(2)23-21-17-9-6-7-10-18(17)24-26(21)20(19)15-11-22-25(4)12-15/h6-7,9-12,16,27H,3,5,8H2,1-2,4H3 |
| InChIKey | HWZDYCRGLGDKRH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|