C26H41FN4O7 — CID 118370196
(1S,8S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-5-fluoro-8-hydroxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 118370196) has the molecular formula C26H41FN4O7 and a molecular weight of 540.63 g/mol. Its IUPAC name is (1S,8S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-5-fluoro-8-hydroxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | (1S,8S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-5-fluoro-8-hydroxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 118370196 |
| Molecular Formula | C26H41FN4O7 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | (1S,8S,11R,13R,14R)-15-(4-azidobutyl)-2-ethyl-5-fluoro-8-hydroxy-1,5,7,9,11,13-hexamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CCC1OC(=O)C(C)(F)C(=O)C(C)[C@@H](O)C(C)C[C@@H](C)C(=O)[C@H](C)[C@H]2N(CCCCN=[N+]=[N-])C(=O)O[C@]12C |
| InChI | InChI=1S/C26H41FN4O7/c1-8-18-26(7)21(31(24(36)38-26)12-10-9-11-29-30-28)16(4)19(32)14(2)13-15(3)20(33)17(5)22(34)25(6,27)23(35)37-18/h14-18,20-21,33H,8-13H2,1-7H3/t14-,15?,16+,17?,18?,20+,21-,25?,26-/m1/s1 |
| InChIKey | ZSNQZTBSJVRTPX-NKJKVAMOSA-N |
| XLogP | 4.15 |
| TPSA | 158.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|