About 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine
1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine (PubChem CID 118370222) has the molecular formula C29H29NO
and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine.
Molecular Properties
| Compound Name | 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine |
| PubChem CID | 118370222 |
| Molecular Formula | C29H29NO |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine |
| SMILES | CC1(c2ccccc2)C=CC(OC2CN(C(c3ccccc3)c3ccccc3)C2)=CC1 |
| InChI | InChI=1S/C29H29NO/c1-29(25-15-9-4-10-16-25)19-17-26(18-20-29)31-27-21-30(22-27)28(23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-19,27-28H,20-22H2,1H3 |
| InChIKey | LZYQWCIGQMATIE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine?
The IUPAC name of 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine (CID 118370222) is 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine.
What is the SMILES notation for 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine?
The canonical SMILES for 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine is CC1(c2ccccc2)C=CC(OC2CN(C(c3ccccc3)c3ccccc3)C2)=CC1.
What is the InChIKey of 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine?
The InChIKey is LZYQWCIGQMATIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29NO/c1-29(25-15-9-4-10-16-25)19-17-26(18-20-29)31-27-21-30(22-27)28(23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-19,27-28H,20-22H2,1H3.
What are the key properties of 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine?
1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine has a molecular weight of 407.56 g/mol, XLogP of 6.28, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydryl-3-(4-methyl-4-phenylcyclohexa-1,5-dien-1-yl)oxyazetidine is sourced from PubChem (CID 118370222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).