C24H30N4O2S — CID 118370281
N'-[(2R)-6-cyclopropyl-2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-1,2-dihydroquinolin-4-yl]propane-1,3-diamine (PubChem CID 118370281) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is N'-[(2R)-6-cyclopropyl-2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-1,2-dihydroquinolin-4-yl]propane-1,3-diamine.
| Compound Name | N'-[(2R)-6-cyclopropyl-2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-1,2-dihydroquinolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 118370281 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N'-[(2R)-6-cyclopropyl-2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-1,2-dihydroquinolin-4-yl]propane-1,3-diamine |
| SMILES | NCCCNC1=C[C@@H](N2CCS(=O)(=O)c3ccccc3C2)Nc2ccc(C3CC3)cc21 |
| InChI | InChI=1S/C24H30N4O2S/c25-10-3-11-26-22-15-24(27-21-9-8-18(14-20(21)22)17-6-7-17)28-12-13-31(29,30)23-5-2-1-4-19(23)16-28/h1-2,4-5,8-9,14-15,17,24,26-27H,3,6-7,10-13,16,25H2/t24-/m1/s1 |
| InChIKey | YCEFWBFNQQDNBI-XMMPIXPASA-N |
| XLogP | 2.88 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|