C24H29NO4S — CID 118370413
(2S,3S,4R,6R)-6-[4-cyclopropyl-3-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)phenyl]-2-methoxyoxane-3,4-diol (PubChem CID 118370413) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is (2S,3S,4R,6R)-6-[4-cyclopropyl-3-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)phenyl]-2-methoxyoxane-3,4-diol.
| Compound Name | (2S,3S,4R,6R)-6-[4-cyclopropyl-3-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)phenyl]-2-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 118370413 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (2S,3S,4R,6R)-6-[4-cyclopropyl-3-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)phenyl]-2-methoxyoxane-3,4-diol |
| SMILES | CO[C@H]1O[C@@H](c2ccc(C3CC3)c(Cc3ccc4c(c3)NCCS4)c2)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29NO4S/c1-28-24-23(27)20(26)13-21(29-24)16-5-6-18(15-3-4-15)17(12-16)10-14-2-7-22-19(11-14)25-8-9-30-22/h2,5-7,11-12,15,20-21,23-27H,3-4,8-10,13H2,1H3/t20-,21-,23+,24+/m1/s1 |
| InChIKey | MHRKHWCQGGBLOA-HTDNTCHWSA-N |
| XLogP | 3.83 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |