C14H27NO2 — CID 118370632
(3R,4R,5S)-5-(1-cyclohexylpropan-2-yl)piperidine-3,4-diol (PubChem CID 118370632) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (3R,4R,5S)-5-(1-cyclohexylpropan-2-yl)piperidine-3,4-diol.
| Compound Name | (3R,4R,5S)-5-(1-cyclohexylpropan-2-yl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 118370632 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (3R,4R,5S)-5-(1-cyclohexylpropan-2-yl)piperidine-3,4-diol |
| SMILES | CC(CC1CCCCC1)[C@H]1CNC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H27NO2/c1-10(7-11-5-3-2-4-6-11)12-8-15-9-13(16)14(12)17/h10-17H,2-9H2,1H3/t10?,12-,13-,14-/m1/s1 |
| InChIKey | AZHPFAZLYZTKRM-FYFXECOGSA-N |
| XLogP | 1.53 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |