C9H16O5S — CID 118371213
[(3S,4R,6S)-3,4,6-trihydroxy-5-methylthian-2-yl]methyl acetate (PubChem CID 118371213) has the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. Its IUPAC name is [(3S,4R,6S)-3,4,6-trihydroxy-5-methylthian-2-yl]methyl acetate.
| Compound Name | [(3S,4R,6S)-3,4,6-trihydroxy-5-methylthian-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118371213 |
| Molecular Formula | C9H16O5S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [(3S,4R,6S)-3,4,6-trihydroxy-5-methylthian-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1S[C@H](O)C(C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H16O5S/c1-4-7(11)8(12)6(15-9(4)13)3-14-5(2)10/h4,6-9,11-13H,3H2,1-2H3/t4?,6?,7-,8-,9+/m1/s1 |
| InChIKey | AQBCQZBCTSWJPW-SLQVKSEKSA-N |
| XLogP | -0.66 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |