C16H22N2O3 — CID 118371306
1,2,3-trimethylspiro[1,3-diazinane-5,5'-2,3,4,4a,6,7-hexahydronaphthalene]-1',4,6-trione (PubChem CID 118371306) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1,2,3-trimethylspiro[1,3-diazinane-5,5'-2,3,4,4a,6,7-hexahydronaphthalene]-1',4,6-trione.
| Compound Name | 1,2,3-trimethylspiro[1,3-diazinane-5,5'-2,3,4,4a,6,7-hexahydronaphthalene]-1',4,6-trione |
|---|---|
| PubChem CID | 118371306 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1,2,3-trimethylspiro[1,3-diazinane-5,5'-2,3,4,4a,6,7-hexahydronaphthalene]-1',4,6-trione |
| SMILES | CC1N(C)C(=O)C2(CCC=C3C(=O)CCCC32)C(=O)N1C |
| InChI | InChI=1S/C16H22N2O3/c1-10-17(2)14(20)16(15(21)18(10)3)9-5-6-11-12(16)7-4-8-13(11)19/h6,10,12H,4-5,7-9H2,1-3H3 |
| InChIKey | HNLJZUPQACNSSG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|