C9H4F5N3S — CID 11837139
4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-2H-triazole (PubChem CID 11837139) has the molecular formula C9H4F5N3S and a molecular weight of 281.21 g/mol. Its IUPAC name is 4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-2H-triazole.
| Compound Name | 4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-2H-triazole |
|---|---|
| PubChem CID | 11837139 |
| Molecular Formula | C9H4F5N3S |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-2H-triazole |
| SMILES | Fc1c(F)c(F)c(CSc2cn[nH]n2)c(F)c1F |
| InChI | InChI=1S/C9H4F5N3S/c10-5-3(2-18-4-1-15-17-16-4)6(11)8(13)9(14)7(5)12/h1H,2H2,(H,15,16,17) |
| InChIKey | AHEFVRHBKFPIDN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|