About [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate
[(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate (PubChem CID 118371854) has the molecular formula C23H24F3NO2
and a molecular weight of 403.44 g/mol. Its IUPAC name is [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate.
Molecular Properties
| Compound Name | [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate |
| PubChem CID | 118371854 |
| Molecular Formula | C23H24F3NO2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate |
| SMILES | CCCC1(CCC(F)(F)F)c2ccccc2-c2ccc(/C(C)=N/OC(C)=O)cc21 |
| InChI | InChI=1S/C23H24F3NO2/c1-4-11-22(12-13-23(24,25)26)20-8-6-5-7-18(20)19-10-9-17(14-21(19)22)15(2)27-29-16(3)28/h5-10,14H,4,11-13H2,1-3H3/b27-15+ |
| InChIKey | YMFQZXBNKZFRSL-JFLMPSFJSA-N |
| XLogP | 6.38 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate?
The IUPAC name of [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate (CID 118371854) is [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate.
What is the SMILES notation for [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate?
The canonical SMILES for [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate is CCCC1(CCC(F)(F)F)c2ccccc2-c2ccc(/C(C)=N/OC(C)=O)cc21.
What is the InChIKey of [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate?
The InChIKey is YMFQZXBNKZFRSL-JFLMPSFJSA-N. The full InChI is InChI=1S/C23H24F3NO2/c1-4-11-22(12-13-23(24,25)26)20-8-6-5-7-18(20)19-10-9-17(14-21(19)22)15(2)27-29-16(3)28/h5-10,14H,4,11-13H2,1-3H3/b27-15+.
What are the key properties of [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate?
[(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate has a molecular weight of 403.44 g/mol, XLogP of 6.38, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylideneamino] acetate is sourced from PubChem (CID 118371854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).