About (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine
(NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine (PubChem CID 118371893) has the molecular formula C21H22F3NO
and a molecular weight of 361.41 g/mol. Its IUPAC name is (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine |
| PubChem CID | 118371893 |
| Molecular Formula | C21H22F3NO |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine |
| SMILES | CCCC1(CCC(F)(F)F)c2ccccc2-c2ccc(/C(C)=N/O)cc21 |
| InChI | InChI=1S/C21H22F3NO/c1-3-10-20(11-12-21(22,23)24)18-7-5-4-6-16(18)17-9-8-15(13-19(17)20)14(2)25-26/h4-9,13,26H,3,10-12H2,1-2H3/b25-14+ |
| InChIKey | CSSNPOOZEZSTIS-AFUMVMLFSA-N |
| XLogP | 6.29 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine?
The IUPAC name of (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine (CID 118371893) is (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine is CCCC1(CCC(F)(F)F)c2ccccc2-c2ccc(/C(C)=N/O)cc21.
What is the InChIKey of (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine?
The InChIKey is CSSNPOOZEZSTIS-AFUMVMLFSA-N. The full InChI is InChI=1S/C21H22F3NO/c1-3-10-20(11-12-21(22,23)24)18-7-5-4-6-16(18)17-9-8-15(13-19(17)20)14(2)25-26/h4-9,13,26H,3,10-12H2,1-2H3/b25-14+.
What are the key properties of (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine?
(NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine has a molecular weight of 361.41 g/mol, XLogP of 6.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]ethylidene]hydroxylamine is sourced from PubChem (CID 118371893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).