C14H12N4O2S — CID 11837212
2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-pyrazin-2-ylacetamide (PubChem CID 11837212) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-pyrazin-2-ylacetamide.
| Compound Name | 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-pyrazin-2-ylacetamide |
|---|---|
| PubChem CID | 11837212 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-pyrazin-2-ylacetamide |
| SMILES | O=C(CC1Sc2ccccc2NC1=O)Nc1cnccn1 |
| InChI | InChI=1S/C14H12N4O2S/c19-13(18-12-8-15-5-6-16-12)7-11-14(20)17-9-3-1-2-4-10(9)21-11/h1-6,8,11H,7H2,(H,17,20)(H,16,18,19) |
| InChIKey | SKCXYQUHEMOEFN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |